- FMOC-L-Valine
-
- $0.00 / 1KG
-
2026-04-30
- CAS:68858-20-8
- Min. Order: 1KG
- Purity: ≥99%
- Supply Ability: 500kg/month
- Fmoc-L-Val-OH
-
- $0.00/ kg
-
2026-04-30
- CAS:68858-20-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-Val-OH
-
- $0.00 / 100gram
-
2025-08-22
- CAS:68858-20-8
- Min. Order: 50gram
- Purity: 99% HPLC
- Supply Ability: 50 gram
|
| | FMOC-L-Valine Basic information |
| | FMOC-L-Valine Chemical Properties |
| Melting point | 143-145 °C(lit.) | | alpha | -16 º (c=1,DMF) | | Boiling point | 475.36°C (rough estimate) | | density | 1.2270 (rough estimate) | | refractive index | -17.5 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | Solubility in methanol gives very faint turbidity. | | pka | 3.90±0.10(Predicted) | | form | Solid | | color | Off-White | | Optical Rotation | [α]20/D 17±1°, c = 1% in DMF | | BRN | 2177443 | | Major Application | peptide synthesis | | InChI | InChI=1S/C20H21NO4/c1-12(2)18(19(22)23)21-20(24)25-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17-18H,11H2,1-2H3,(H,21,24)(H,22,23)/t18-/m0/s1 | | InChIKey | UGNIYGNGCNXHTR-SFHVURJKSA-N | | SMILES | C(O)(=O)[C@H](C(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 68858-20-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 36/37/39-26-22-27-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-Valine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Fmoc-Val-OH is potentially useful for proteomics studies and solid phase peptide synthesis techniques. Fmoc-valine (in addition to the other amino acids) is commonly used to synthesize 4-thiazolidinones (e.g. (E)-5-(4-Ethylbenzylidene)-2-thioxothiazolidin-4-one [E925745]) and 4-metathiazanones as well. | | General Description | FMOC-L-Valine is potentially useful for proteomics studies and solid phase peptide synthesis techniques. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-Valine Preparation Products And Raw materials |
| Raw materials | L-Valine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 1,1-dimethyl-2-propen-1-yl ester-->3(2H)-Benzothiazolecarboxylic acid, 2-thioxo-, 9H-fluoren-9-ylmethyl ester-->FMOC-D-Valine-->FMoc-DL-valine-->FMOC-VAL-OPFP-->L-Valine | | Preparation Products | Pepstatin-->Fmoc-Val-Ala-PAB-OH-->ANGIOTENSIN I, HUMAN-->tert-butyl (5S,8S,11S,12R)-11-((S)-sec-butyl)-1-(9H-fluoren-9-yl)-5,8-diisopropyl-12-methoxy-4,10-dimethyl-3,6,9-trioxo-2-oxa-4,7,10-triazatetradecan-14-oate-->MELITTIN-->MC-Val-Cit-PAB-->FMoc-Val-Cit-PAB-->FMoc-Val-Cit-PAB-PNP-->Mc-Val-Cit-PABC-PNP |
|