|
|
| | M-CRESOL PURPLE, SODIUM SALT Basic information |
| | M-CRESOL PURPLE, SODIUM SALT Chemical Properties |
| Melting point | >250°C | | storage temp. | room temp | | solubility | Solubility Soluble in water, ethanol | | pka | 1.51, 8.32(at 25℃) | | form | Powder | | color | Orange-brown to black | | PH Range | 1.2(red)-2.8(yellow) 7.4(yellow)-9(purple) | | Water Solubility | Soluble in water. | | λmax | 436nm | | ε(extinction coefficient) | ≥15000 at 433-439nm in H2O at 0.008g/L | | Major Application | Screening method of endocrine disrupting chemicals | | InChI | 1S/C21H18O5S.Na/c1-13-11-15(22)7-9-17(13)21(18-10-8-16(23)12-14(18)2)19-5-3-4-6-20(19)27(24,25)26;/h3-12,22H,1-2H3,(H,24,25,26);/q;+1/p-1/b21-18+; | | InChIKey | BYQJYOOKENJSNK-GOSREXKOSA-M | | SMILES | [Na+].Cc1cc(O)ccc1\C(=C2\C=CC(=O)C=C2C)c3ccccc3S([O-])(=O)=O | | CAS DataBase Reference | 62625-31-4 | | EPA Substance Registry System | Phenol, 4,4'-(2,2-dioxido-3H-1,2-benzoxathiol-3-ylidene)bis[3-methyl-, monosodium salt (62625-31-4) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids |
| | M-CRESOL PURPLE, SODIUM SALT Usage And Synthesis |
| Chemical Properties | orange-brown to black powder | | Uses | m-Cresol purple sodium salt is used to detect changes in pH during titrations at which color changes occur at pH 7.6-9.2. Upon bromination, m-cresol purple sodium salt creates the dye bromocresol green (sc-206036) which is used as a tracking dye in DNA agarose gel electrophoresis. In addition, m-cresol purple sodium salt can be used to stain epithelial cells and proteins. |
| | M-CRESOL PURPLE, SODIUM SALT Preparation Products And Raw materials |
|