|
|
| | 4-(chloromethyl)-2-methylpyridine hydrochloride Basic information |
| | 4-(chloromethyl)-2-methylpyridine hydrochloride Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H8ClN.ClH/c1-6-4-7(5-8)2-3-9-6;/h2-4H,5H2,1H3;1H | | InChIKey | MUEOGQBVZGRFJN-UHFFFAOYSA-N | | SMILES | C(C1=CC=NC(C)=C1)Cl.Cl |
| | 4-(chloromethyl)-2-methylpyridine hydrochloride Usage And Synthesis |
| Uses |
4-(chloromethyl)-2-methylpyridine hydrochloride is a pyridine derivative that is a component in the synthesis of various organic compounds. It is mainly used in the field of organic synthesis, and can be used as an intermediate in the production of pharmaceuticals and agrochemicals, and can also be used as a modifying reagent for certain compounds in organic synthesis.
| | Chemical Properties | 4-(chloromethyl)-2-methylpyridine hydrochloride is a colourless to light yellow crystalline solid with a melting point of 155-156°C and a boiling point of 277-278°C, a density of 1.22 g/cm3, a refractive index of 1.551, and pKa values of 2.31 and 7.61. It is very soluble in water, Soluble in methanol, ethanol, chloroform and dichloromethane. | | Biological Activity | 4-(chloromethyl)-2-methylpyridine hydrochloride has antimicrobial, anti-inflammatory and anti-tumour properties. It has been investigated as a potential treatment for various diseases, including cancer and Alzheimer's disease. However, further studies are needed to fully understand its biological properties and potential therapeutic applications. |
| | 4-(chloromethyl)-2-methylpyridine hydrochloride Preparation Products And Raw materials |
|