| Company Name: |
chengqiaotech.ltd Gold |
| Tel: |
0533-2196219; 13864320634 |
| Email: |
lijindu01@163.com |
| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | 3-azidopropyl 4-methylbenzenesulfonate Basic information |
| Product Name: | 3-azidopropyl 4-methylbenzenesulfonate | | Synonyms: | 3-azidopropyl 4-methylbenzenesulfonate;1-[(3-Azidopropoxy)sulfonyl]-4-methylbenzene;3-Azidopropyl tosylate;1-Propanol, 3-azido-, 1-(4-methylbenzenesulfonate);1-Propanol, 3-azido-, 4-methylbenzenesulfonate (ester);paramethylbenzenesulfonylacid3-azapropyl ester | | CAS: | 153207-76-2 | | MF: | C10H13N3O3S | | MW: | 255.29 | | EINECS: | | | Product Categories: | | | Mol File: | 153207-76-2.mol |  |
| | 3-azidopropyl 4-methylbenzenesulfonate Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Solid-Liquid Mixture | | InChI | InChI=1S/C10H13N3O3S/c1-9-3-5-10(6-4-9)17(14,15)16-8-2-7-12-13-11/h3-6H,2,7-8H2,1H3 | | InChIKey | MMGDPHCMLPGJAE-UHFFFAOYSA-N | | SMILES | S(C1C=CC(C)=CC=1)(=O)(=O)OCCCN=[N+]=[N-] |
| | 3-azidopropyl 4-methylbenzenesulfonate Usage And Synthesis |
| Uses | 3-Azidopropyl Tosylate is an intermediate in the synthesis of 3-Azidopropyl Tosylate (S064550). |
| | 3-azidopropyl 4-methylbenzenesulfonate Preparation Products And Raw materials |
|