|
|
| | 1-Fluoro-2-(2-nitrovinyl)benzene Basic information |
| Product Name: | 1-Fluoro-2-(2-nitrovinyl)benzene | | Synonyms: | o-fluoro-beta-nitrostyrene;2-fluoro-β-nitrostyrene;2-Fluoro-beta-nitrostyrene 98%;2-Fluoro-beta-nitrostyrene98%;2-Fluor-beta-nitrostyrol;2-FLUORO-B-NITROSTYRENE;2'-FLUORO-BETA-NITROSTYRENE;2-FLUORO-BETA-NITROSTYRENE | | CAS: | 399-25-7 | | MF: | C8H6FNO2 | | MW: | 167.14 | | EINECS: | 206-915-3 | | Product Categories: | | | Mol File: | 399-25-7.mol |  |
| | 1-Fluoro-2-(2-nitrovinyl)benzene Chemical Properties |
| Melting point | 55-57 °C | | Boiling point | 254.5±15.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | form | solid | | color | Pale yellow | | BRN | 2556034 | | InChI | 1S/C8H6FNO2/c9-8-4-2-1-3-7(8)5-6-10(11)12/h1-6H/b6-5+ | | InChIKey | NKZSNHAEWKEFNE-AATRIKPKSA-N | | SMILES | [O-][N+](=O)\C=C\c1ccccc1F |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2904990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-Fluoro-2-(2-nitrovinyl)benzene Usage And Synthesis |
| | 1-Fluoro-2-(2-nitrovinyl)benzene Preparation Products And Raw materials |
|