- 4-BENZYLANILINE
-
- $8.00
-
2019-07-06
- CAS:1135-12-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10tons
|
| | 4-BENZYLANILINE Basic information |
| | 4-BENZYLANILINE Chemical Properties |
| Melting point | 35-38 °C(lit.) | | Boiling point | 142-144°C 1mm | | density | 1.0380 | | refractive index | 1.6118 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | pka | 2.17(at 25℃) | | form | powder to lump to clear liquid | | color | White or colorless to Amber to Dark green | | BRN | 2208463 | | InChI | InChI=1S/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 | | InChIKey | WDTRNCFZFQIWLM-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(CC2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 1135-12-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids |
| | 4-BENZYLANILINE Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 4-Benzylaniline (4-Aminodiphenylmethane) can be used to synthesize:
- 2-amino-6-benzylbenzothiazole (SKA-7)
- ethyl 2-((4-benzylphenylamino)methylen)-malonate
- bis(4-benzylphenyl)-urea
- 3:5-dibromo-4-aminodiphenylmethane via treatment with bromine solution
- 3:5-di-iodo-4-aminodiphenylmethane via iodination reaction by using a suitable iodinating reagent[sodium iodate + potassium iodide]
| | General Description | 4-Benzylaniline (4-BA) undergoes hydrochlorination in the presence of HCl to yield 4-benzylaniline hydrochloride. Crystals of 4-BA exhibit monoclinic crystal system and space group P21/c. |
| | 4-BENZYLANILINE Preparation Products And Raw materials |
|