|
|
| | HARMANE-1,2,3,4-TETRAHYDRO-3-CARBOXYLIC ACID Basic information |
| Product Name: | HARMANE-1,2,3,4-TETRAHYDRO-3-CARBOXYLIC ACID | | Synonyms: | HARMANE-1,2,3,4-TETRAHYDRO-3-CARBOXYLIC ACID;AKOS BBS-00007526;AKOS BC-2998;OTAVA-BB BB5030340394;1-METHYL-2,3,4,9-TETRAHYDRO-1H-B-CARBOLINE-3-CARBOXYLIC ACID;1-METHYL-2,3,4,9-TETRAHYDRO-1H-BETA-CARBOLINE-3-CARBOXYLIC ACID;1,2,3,4-TETRAHYDROHARMAN-3-CARBOXYLIC ACID;1,2,3,4-TETRAHYDROHARMANE-3-CARBOXYLIC ACID | | CAS: | 5470-37-1 | | MF: | C13H14N2O2 | | MW: | 230.26 | | EINECS: | | | Product Categories: | Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;Building Blocks;C13 to C42+;Carbonyl Compounds | | Mol File: | 5470-37-1.mol |  |
| | HARMANE-1,2,3,4-TETRAHYDRO-3-CARBOXYLIC ACID Chemical Properties |
| Melting point | 242-243 °C (decomp) | | Boiling point | 488.0±45.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Methanol (Slightly, Heated) | | pka | 2.29±0.40(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | food and beverages pharmaceutical | | InChI | 1S/C13H14N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-5,7,11,14-15H,6H2,1H3,(H,16,17) | | InChIKey | ZUPHXNBLQCSEIA-UHFFFAOYSA-N | | SMILES | CC1NC(Cc2c1[nH]c3ccccc23)C(O)=O | | CAS DataBase Reference | 5470-37-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | RIDADR | 1544 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III |
| | HARMANE-1,2,3,4-TETRAHYDRO-3-CARBOXYLIC ACID Usage And Synthesis |
| Uses | Reactant involved in synthesis of molecules for biological studies including:• ;Cytotoxicity and insecticidal activities of harmine derivatives1• ;Isoquinolines, β-carbolines, and 3-deazapurines via oxidative decarboxylation2• ;Cytotoxic evaluation of 1,3-di- and 1,3,9-trisubstituted β-carbolines3 | | Uses | Reactant involved in synthesis of molecules for biological studies including:
- Cytotoxicity and insecticidal activities of harmine derivatives
- Isoquinolines, β-carbolines, and 3-deazapurines via oxidative decarboxylation
- Cytotoxic evaluation of 1,3-di- and 1,3,9-trisubstituted β-carbolines
| | Definition | ChEBI: (1xi,3xi)-1,2,3,4-Tetrahydro-1-methyl-beta-carboline-3-carboxylic acid is a harmala alkaloid. | | General Description | Pharmaceutical secondary standards for application in quality control provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards |
| | HARMANE-1,2,3,4-TETRAHYDRO-3-CARBOXYLIC ACID Preparation Products And Raw materials |
|