|
|
| | (±)-α-Tocopherol nicotinate Basic information |
| Product Name: | (±)-α-Tocopherol nicotinate | | Synonyms: | [2R*(4R*,8R*)]-(+/-)-3,4-Dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-yl nicotinate;ALPHA-TOCOPHERYL NICOTINATE;Vitamin E Nicotinamite;Juvela nicotinate;rac-3-Pyridinecarboxylic acid (R*)-2,5,7,8-tetramethyl-2-[(4R*,8R*)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-yl ester;C12981;2R(4R,8R)]3-Pyridnecarboxyic acid;3,4-dihydro-2,5,7,8-tetramehyl- 2(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-yl ester | | CAS: | 51898-34-1 | | MF: | C35H53NO3 | | MW: | 535.8 | | EINECS: | 257-501-4 | | Product Categories: | Vitamin Ingredients | | Mol File: | 51898-34-1.mol |  |
| | (±)-α-Tocopherol nicotinate Chemical Properties |
| Melting point | approximate 38℃ | | alpha | [α]D20 0±0.5゜ (c=5, C2H5OH) | | Boiling point | 649.0±55.0 °C(Predicted) | | density | 0.9611 g/cm3 | | storage temp. | 2-8°C | | pka | 3.03±0.10(Predicted) | | form | Solid | | color | White to off-white | | Cosmetics Ingredients Functions | SKIN CONDITIONING
SKIN PROTECTING
ANTIOXIDANT | | InChIKey | MSCCTZZBYHQMQJ-AZAGJHQNSA-N | | SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(OC(=O)c3cccnc3)c(C)c(C)c2O1 | | CAS DataBase Reference | 51898-34-1(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (±)-α-Tocopherol nicotinate Usage And Synthesis |
| Uses | (±)-α-Tocopherol nicotinate is used as an anti-oxidant and a skin-conditioning agent. | | Definition | ChEBI: Tocopheryl nicotinate is a tocol. | | Biological Activity | α-Tocopherol is a radical-chain breaker owing to its anti-oxidant property.', 'Tocopherols (TCP) (vitamin E) are a series (α, β, γ and δ) of chiral organic molecules th at vary in their degree of methylation of the phenol moiety of the chromanol ring. Tocopherols are lipid soluble anti-oxidants th at protect cell membranes from oxidative damage. α-Tocopherol is the form of tocopherol preferentially absorbed by homo sapiens. α-Tocopherol nicotinate is used along the α-Tocopherol acetate, α-Tocopherol succinate and other esterified forms as a vitamin E supplement with similar but differential activities. | | in vivo | (±)-α-Tocopherol nicotinate (Vitamin E) (in animal feedings, 50 mg/kg or 585 mg/kg, 7 weeks) significantly increases the proportion of CD4+CD8- T cells and the expression of ICAM-1 in thymic epithelial cells (TECs) isolated of male Fisher rats at high dose concentrations of 585 mg/kg compared to low dose treatment of 50 mg/kg[2].
|
| | (±)-α-Tocopherol nicotinate Preparation Products And Raw materials |
|