- Gitogenin
-
- $64.00 / 1mg
-
2026-02-01
- CAS:511-96-6
- Min. Order:
- Purity: 99.73%
- Supply Ability: 10g
- Gitogenin
-
- $0.00 / 5mg
-
2023-02-24
- CAS:511-96-6
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | (25R)-5ALPHA-SPIROSTAN-2ALPHA,3BETA-DIOL Basic information |
| Product Name: | (25R)-5ALPHA-SPIROSTAN-2ALPHA,3BETA-DIOL | | Synonyms: | GITOGENIN;DIGIN;(25R)-2α,3β-Dihydroxy-5α-spirostan;(25R)-2α,3β-Dihydroxy-5α-spirostane;(2alpha,3beta,5alpha,25R)-Spirostan-2,3-diol;2alpha-Hydroxytigogenin;(25R)-5ALPHA-SPIROSTAN-2ALPHA,3BETA-DIOL;NSC 147752 | | CAS: | 511-96-6 | | MF: | C27H44O4 | | MW: | 432.64 | | EINECS: | | | Product Categories: | | | Mol File: | 511-96-6.mol |  |
| | (25R)-5ALPHA-SPIROSTAN-2ALPHA,3BETA-DIOL Chemical Properties |
| Melting point | 272-273℃ | | alpha | D20 -75° (c = 1.02 in CHCl3) | | Boiling point | 466.26°C (rough estimate) | | density | 1.16 | | refractive index | 1.4840 (estimate) | | solubility | Chloroform: 30 mg/ml | | pka | 14.62±0.70(Predicted) | | form | A solid | | color | White to off-white | | InChIKey | FWCXELAAYFYCSR-RYKNUXCGSA-N | | SMILES | O[C@H]1[C@H](O)C[C@@](CC[C@]2([H])[C@]3([H])CC[C@@]4(C)[C@@]2([H])C[C@@]5([H])[C@]4([H])[C@H](C)[C@]6(OC[C@H](C)CC6)O5)([H])[C@]3(C)C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (25R)-5ALPHA-SPIROSTAN-2ALPHA,3BETA-DIOL Usage And Synthesis |
| Chemical Properties | Powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Ophiopogon japonicus, Saposhnikovia divaricata, Fenugreek root, Tribulus terrestris root, and Giant fish maw flower. | | Uses | Gitogenin is isolated from a methanolic extract of the whole plant of Tribulus longipetalus which exhibits inhibitory activities against α-glucosidase, lipoxygenase, acetylcholinesterase and butyrylcholinesterase. | | Definition | ChEBI: Gitogenin is a triterpenoid. | | in vivo | Stimulation of growth hormone release is investigated on rat pituitary cells in vitro. Gitogenin (20 μg/mL) shows rat growth-hormone (rGH) release stimulating activities (26.1 ng/mL)[3]. |
| | (25R)-5ALPHA-SPIROSTAN-2ALPHA,3BETA-DIOL Preparation Products And Raw materials |
|