|
|
| | 5-Mercapto-1H-tetrazole-1-acetic acid Basic information |
| Product Name: | 5-Mercapto-1H-tetrazole-1-acetic acid | | Synonyms: | MTAA;5-MERCAPTOTETRAZOLE-1-ACETIC ACID;5-MERCAPTOTETRAZOLYLACETIC ACID SODIUM SALT;5-MERCAPTO-1H-TETRAZOLE-1-ACETIC ACID;2,5-dihydro-5-thioxo-1H-tetrazol-1-acetic acid;MTAA:5- MERCAPTO-1H- TETRAZOLE –1-ACETIC ACID;(5-Mercapto-1H-tetrazol-1-yl)acetic acid;2,5-Dihydro-5-thioxo-1H-tetrazole-1-acetic acid | | CAS: | 57658-36-3 | | MF: | C3H4N4O2S | | MW: | 160.15 | | EINECS: | 260-884-0 | | Product Categories: | Organic acids | | Mol File: | 57658-36-3.mol |  |
| | 5-Mercapto-1H-tetrazole-1-acetic acid Chemical Properties |
| Melting point | 179-180 °C (decomp) | | Boiling point | 284.7±42.0 °C(Predicted) | | density | 1.99±0.1 g/cm3(Predicted) | | pka | 3.31±0.10(Predicted) | | InChI | InChI=1S/C3H4N4O2S/c8-2(9)1-7-3(10)4-5-6-7/h1H2,(H,8,9)(H,4,6,10) | | InChIKey | UOTQEHLQKASWQO-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)C(=S)N=NN1 | | CAS DataBase Reference | 57658-36-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-63 | | Safety Statements | 22-36/37 | | RIDADR | UN 0448 (5-MERCAPTOTETRAZOL-1-
ACETIC ACID) | | HazardClass | 1.4C |
| | 5-Mercapto-1H-tetrazole-1-acetic acid Usage And Synthesis |
| Uses | 5-Mercapto-1-tetrazolylacetic Acid is a novel capping ligand for the stabilization of metal nanoparticles in water. 5-Mercapto-1-tetrazolylacetic Acid is an intermediate in the synthesis of Ceforanide (C242930), a cephalosporin based antibiotic used in the sterilization in various medical procedures. |
| | 5-Mercapto-1H-tetrazole-1-acetic acid Preparation Products And Raw materials |
|