- H-L-Phe-OtBu.HCl
-
- $0.00 / 1kg
-
2026-02-02
- CAS:15100-75-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | tert-Butyl 3-phenyl-L-alaninate hydrochloride Basic information |
| | tert-Butyl 3-phenyl-L-alaninate hydrochloride Chemical Properties |
| Melting point | 240℃ | | storage temp. | 2-8°C | | solubility | Soluble in methanol. | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +47.0±1°, c = 2% in ethanol | | Sensitive | Hygroscopic | | BRN | 4723424 | | Major Application | peptide synthesis | | InChI | 1S/C13H19NO2.ClH/c1-13(2,3)16-12(15)11(14)9-10-7-5-4-6-8-10;/h4-8,11H,9,14H2,1-3H3;1H/t11-;/m0./s1 | | InChIKey | FDMCEXDXULPJPG-MERQFXBCSA-N | | SMILES | Cl.CC(C)(C)OC(=O)[C@@H](N)Cc1ccccc1 | | CAS DataBase Reference | 15100-75-1(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 3 | | Storage Class | 11 - Combustible Solids |
| | tert-Butyl 3-phenyl-L-alaninate hydrochloride Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | L-Phenylalanine tert-Butyl Ester is an derivative of L-Phenylalanine (P319415), an essential amino acid. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | tert-Butyl 3-phenyl-L-alaninate hydrochloride Preparation Products And Raw materials |
|