| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:L-Tyrosine-13C9,15N
CAS:202407-26-9
Purity:98 atom % 15N, 98 atom % 13C, 95% (CP) Package:250MG Remarks:607991-250MG
|
| Company Name: |
Shanghai EFE Biological Technology Co., Ltd.
|
| Tel: |
021-65675885 18964387627 |
| Email: |
info@efebio.com |
| Products Intro: |
Product Name:L-TYROSINE (13C9, 99%; 15N, 99%)
CAS:202407-26-9
Purity:98% Package:25mg;50mg;100mg
|
| Company Name: |
Wuhan eastop Technology Co., ltd.6
|
| Tel: |
18086015167 17702779303 |
| Email: |
service@isotopechina.com |
| Products Intro: |
Product Name:L-TYROSINE(13C9; 15N)
CAS:202407-26-9
|
L-4-HYDROXYPHENYLALANINE-13C9,15N manufacturers
- L-Tyrosine-13C9,15N
-
- $58.00 / 1mg
-
2026-01-05
- CAS:202407-26-9
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | L-4-HYDROXYPHENYLALANINE-13C9,15N Basic information |
| Product Name: | L-4-HYDROXYPHENYLALANINE-13C9,15N | | Synonyms: | L-4-HYDROXYPHENYLALANINE-13C9,15N;L-TYROSINE-13C9,15N;L-TYROSINE (U-13C9, 15N);[13C9,15N]-L-Tyrosine;L-Tyrosine-13C?,1?N;L-Tyrosine-13C9,15N;DL-Tyrosine-13C9,15N;L-Tyrosine (13C?, 99% | | CAS: | 202407-26-9 | | MF: | C9H11NO3 | | MW: | 191.28 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | L-4-HYDROXYPHENYLALANINE-13C9,15N Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D -12.0°, c = 1 in 1 M HCl | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 | | InChIKey | OUYCCCASQSFEME-CMLFETTRSA-N | | SMILES | [15NH2][13C@@H]([13CH2][13c]1[13cH][13cH][13c](O)[13cH][13cH]1)[13C](O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-4-HYDROXYPHENYLALANINE-13C9,15N Usage And Synthesis |
| Uses | L-Tyrosine-13C9 ,15N is labelled analogue of L-Tyrosine (T899975), one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine. |
| | L-4-HYDROXYPHENYLALANINE-13C9,15N Preparation Products And Raw materials |
|