- N-TERT-OCTYLACRYLAMIDE
-
- $20.00 / 1KG
-
2025-12-12
- CAS:4223-03-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 52000KG
- N-TERT-OCTYLACRYLAMIDE
-
- $0.00 / 1kG
-
2025-12-12
- CAS:4223-03-4
- Min. Order: 1kG
- Purity: 99%
- Supply Ability: 1000KG
- N-TERT-OCTYLACRYLAMIDE
-
- $1.00 / 1KG
-
2025-12-12
- CAS:1223-03-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
|
| | N-TERT-OCTYLACRYLAMIDE Basic information |
| Product Name: | N-TERT-OCTYLACRYLAMIDE | | Synonyms: | TERTIARY-OCTYL ACRYLAMIDE;N-TERT-OCTYLACRYLAMIDE;T-OCTYLACRYLAMIDE;TOA;2-Propenamide,N-(1,1,3,3-tetramethylbutyl)-;Acrylamide, N-(1,1,3,3-tetramethylbutyl)-;Acrylamide, N-(5,5-dimethylhexyl)-;n-(1,1,3,3-tetramethylbutyl)-2-propenamid | | CAS: | 4223-03-4 | | MF: | C11H21NO | | MW: | 183.29 | | EINECS: | 224-169-7 | | Product Categories: | monomer | | Mol File: | 4223-03-4.mol |  |
| | N-TERT-OCTYLACRYLAMIDE Chemical Properties |
| Melting point | 63-64°C | | Boiling point | 289.6±13.0 °C(Predicted) | | density | 0.867±0.06 g/cm3(Predicted) | | vapor pressure | 0.064Pa at 20℃ | | solubility | soluble in Methanol | | pka | 15.10±0.46(Predicted) | | form | powder to lump | | color | White to Orange to Green | | Water Solubility | 1.01g/L at 20℃ | | InChI | InChI=1S/C11H21NO/c1-7-9(13)12-11(5,6)8-10(2,3)4/h7H,1,8H2,2-6H3,(H,12,13) | | InChIKey | YRDNVESFWXDNSI-UHFFFAOYSA-N | | SMILES | C(NC(C)(C)CC(C)(C)C)(=O)C=C | | LogP | 2.25 at 25℃ | | EPA Substance Registry System | 2-Propenamide, N-(1,1,3,3-tetramethylbutyl)- (4223-03-4) |
| | N-TERT-OCTYLACRYLAMIDE Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | N-TERT-OCTYLACRYLAMIDE Preparation Products And Raw materials |
|