|
|
| | 1,2-Bis(triethoxysilyl)ethane Basic information |
| Product Name: | 1,2-Bis(triethoxysilyl)ethane | | Synonyms: | HEXAETHOXYDISILETHYLENE;BIS(TRIETHOXYSILYL)ETHANE;1,2-BIS(TRIETHOXYSILYL)ETHANE;1,2-Bis(triethoxysilyl)ethane(Hexaethoxydisilethylene);3,8-dioxa-4,7-disiladecane,,4,7,7-tetraethoxy-;4,4,7,7-tetraethoxy-3,8-dioxa-4,7-disiladecane;7-disiladecane,4,4,7,7-tetraethoxy-8-dioxa-4;((triethoxysilyl)ethyl)triethoxysilane | | CAS: | 16068-37-4 | | MF: | C14H34O6Si2 | | MW: | 354.59 | | EINECS: | 240-212-2 | | Product Categories: | silane;Bridged MonomersSelf Assembly&Contact Printing;POSS? Precursors and Intermediates;Silane Coupling Agents/Adhesion Promoters;SilanesSelf Assembly&Contact Printing;Silsesquioxanes: POSS? Nanohybrids;Tri-Alkoxy&Greater SilanesOrganometallic Reagents;Organosilicon;Self-Assembly Materials;Trialkoxysilanes;Industrial/Fine Chemicals | | Mol File: | 16068-37-4.mol |  |
| | 1,2-Bis(triethoxysilyl)ethane Chemical Properties |
| Melting point | -20-10°C | | Boiling point | 119 °C(lit.) | | density | 0.958 g/mL at 25 °C(lit.) | | vapor pressure | 0-7910Pa at 20-25℃ | | refractive index | n20/D 1.411(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.957 | | Water Solubility | Soluble in alcohol, aromatic and aliphatic hydrocarbons. Hydrolyzes with water. | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C14H34O6Si2/c1-7-15-21(16-8-2,17-9-3)13-14-22(18-10-4,19-11-5)20-12-6/h7-14H2,1-6H3 | | InChIKey | IZRJPHXTEXTLHY-UHFFFAOYSA-N | | SMILES | CCO[Si](CC[Si](OCC)(OCC)OCC)(OCC)OCC | | LogP | -4-2.7 at 20-25℃ | | CAS DataBase Reference | 16068-37-4 | | EPA Substance Registry System | 3,8-Dioxa-4,7-disiladecane, 4,4,7,7-tetraethoxy- (16068-37-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41-38-37-36 | | Safety Statements | 26-36 | | RIDADR | 2810 | | WGK Germany | 3 | | RTECS | JG7755000 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Chronic 3 STOT RE 1 Inhalation |
| | 1,2-Bis(triethoxysilyl)ethane Usage And Synthesis |
| Chemical Properties | Colorless transparent liquid | | Uses | 1,2-Bis(triethoxysilyl)ethane is used as coating auxiliary agents, leather auxiliary agents, plastic auxiliary agents, surfactants and textile auxiliary agents. It is used to prepare mesoporous organosilica materials. | | Uses | 1,2-bis(triethoxysilyl)ethane may be used to prepare mesoporous organosilica materials. Amine functionalization of mesoporous silica can be undertaken by this silane. It may form inorganic hybrid membranes with poly(vinyl alcohol). Effect of this crosslinking silane on the bonding of bis-GMA (bis-phenol-A-diglycidyldimethacrylate) resin to silicatized titanium was investigated. | | General Description | 1,2-bis(triethoxysilyl)ethane is a non-functional silane and a double trialkoxysilyl precursor. | | Flammability and Explosibility | Not classified |
| | 1,2-Bis(triethoxysilyl)ethane Preparation Products And Raw materials |
|