5-BROMO-N3-METHYL-PYRAZINE-2,3-DIAMINE manufacturers
|
| 5-BROMO-N3-METHYL-PYRAZINE-2,3-DIAMINE Basic information |
| 5-BROMO-N3-METHYL-PYRAZINE-2,3-DIAMINE Chemical Properties |
Melting point | 132-137 °C | Boiling point | 330.0±42.0 °C(Predicted) | density | 1.784±0.06 g/cm3(Predicted) | storage temp. | 2-8°C, protect from light | pka | 2.93±0.10(Predicted) | form | solid | Appearance | White to off-white Solid | InChI | InChI=1S/C5H7BrN4/c1-8-5-4(7)9-2-3(6)10-5/h2H,1H3,(H2,7,9)(H,8,10) | InChIKey | KAXGNNJZVMTPNM-UHFFFAOYSA-N | SMILES | C1(N)=NC=C(Br)N=C1NC |
Hazard Codes | Xi | Risk Statements | 43 | Safety Statements | 36/37-36 | WGK Germany | 3 |
| 5-BROMO-N3-METHYL-PYRAZINE-2,3-DIAMINE Usage And Synthesis |
| 5-BROMO-N3-METHYL-PYRAZINE-2,3-DIAMINE Preparation Products And Raw materials |
|