|
|
| | (Perfluorodecyl)ethylene Basic information |
| Product Name: | (Perfluorodecyl)ethylene | | Synonyms: | (PERFLUORODECYL)ETHYLENE;(N-Perfluorodecyl)ethylene;1-Dodecene, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro-;Perfluorododecene;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecene;1H,1H,2H-PERFLUORODODEC-1-ENE;1H,1H,2H-PERFLUORO-1-DODECENE;1H,1H,2H-Perfluorododec-1-ene 97% | | CAS: | 30389-25-4 | | MF: | C12H3F21 | | MW: | 546.12 | | EINECS: | 250-173-3 | | Product Categories: | | | Mol File: | 30389-25-4.mol |  |
| | (Perfluorodecyl)ethylene Chemical Properties |
| Boiling point | 71-72°C 14mm | | density | 1,711 g/cm3 | | refractive index | 1.303 | | Fp | 71-72°C/14mm | | form | low melting solid | | Specific Gravity | 1.711 | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | BRN | 2493721 | | Henry's Law Constant | 3.3×10-8 mol/(m3Pa) at 25℃, Goss et al. (2006) | | InChI | InChI=1S/C12H3F21/c1-2-3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)33/h2H,1H2 | | InChIKey | UCHSAVGOZUCXHC-UHFFFAOYSA-N | | SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 30389-25-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1h,1h,2h-Perfluoro-1-dodecene(30389-25-4) | | EPA Substance Registry System | (Perfluorodecyl)ethylene (30389-25-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2903590090 |
| Provider | Language |
|
ALFA
| English |
| | (Perfluorodecyl)ethylene Usage And Synthesis |
| Uses | 1H,1H,2H-Perfluoro-1-dodecene is used in preparation method of coating for surface modification of photoresist. |
| | (Perfluorodecyl)ethylene Preparation Products And Raw materials |
|