|
|
| | 1-PHENYL-4,5-DICHLORO-6-PYRIDAZONE Basic information |
| Product Name: | 1-PHENYL-4,5-DICHLORO-6-PYRIDAZONE | | Synonyms: | 4-Hydroxy-7-(trifluoromethyl)quinoline-3-carboxylic acid 85%;4-Hydroxy-7-(trifluoromethyl)quinoline-3-carboxylicacid85%;4,5-Dichlor-2-phenyl-3(2H)pyridazinon;1-Phenyl-4,5-dichloro-6-pyridazine, GC 99%;4,5-DICHLORO-2-PHENYLPYRIDAZINE-3-ONE;4,5-Dichloro-2-phenyl-2H-pyridazin-3-one;2-Phenyl-4,5-dichloro-2,3-dihydropyridazine-3-one;2-Phenyl-4,5-dichloropyridazine-3(2H)-one | | CAS: | 1698-53-9 | | MF: | C10H6Cl2N2O | | MW: | 241.07 | | EINECS: | 216-917-6 | | Product Categories: | Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyridazines;PyridazinesHeterocyclic Building Blocks;Pyridines, Pyrimidines, Purines and Pteredines | | Mol File: | 1698-53-9.mol |  |
| | 1-PHENYL-4,5-DICHLORO-6-PYRIDAZONE Chemical Properties |
| Melting point | 164-166 °C (lit.) | | Boiling point | 307.0±52.0 °C(Predicted) | | density | 1.4887 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | -3.44±0.60(Predicted) | | color | Light beige | | InChI | 1S/C10H6Cl2N2O/c11-8-6-13-14(10(15)9(8)12)7-4-2-1-3-5-7/h1-6H | | InChIKey | VKWCOHVAHQOJGU-UHFFFAOYSA-N | | SMILES | ClC1=C(Cl)C(=O)N(N=C1)c2ccccc2 | | CAS DataBase Reference | 1698-53-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 2 | | RTECS | UR6200000 | | Hazard Note | Irritant | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-PHENYL-4,5-DICHLORO-6-PYRIDAZONE Usage And Synthesis |
| Chemical Properties | light beige crystalline powder | | Uses | 1-Phenyl-4,5-dichloro-6-pyridazone is part of a group of arylated pyridazin-3(2H)-one compounds that act as anti-cancer agents. 1-Phenyl-4,5-dichloro-6-pyridazone also has herbicidal activity. | | Synthesis Reference(s) | Journal of the American Chemical Society, 75, p. 1909, 1953 DOI: 10.1021/ja01104a038 |
| | 1-PHENYL-4,5-DICHLORO-6-PYRIDAZONE Preparation Products And Raw materials |
|