- L-Arg-Ome.2Hcl
-
- $0.00 / 1kg
-
2026-01-28
- CAS:26340-89-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | Methyl L-argininate dihydrochloride Basic information |
| | Methyl L-argininate dihydrochloride Chemical Properties |
| Melting point | ~190 °C (dec.) | | alpha | 20 º (c=2.5 CH3OH) | | refractive index | 21 ° (C=2.5, MeOH) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | color | White to off-white | | Optical Rotation | [α]20/D +21±1°, c = 2.5% in methanol | | Sensitive | Hygroscopic | | BRN | 4159929 | | Major Application | peptide synthesis | | InChI | InChI=1/C7H16N4O2.2ClH/c1-13-6(12)5(8)3-2-4-11-7(9)10;;/h5H,2-4,8H2,1H3,(H4,9,10,11);2*1H/t5-;;/s3 | | InChIKey | XQYZOBNLCUAXLF-WHWWGIJDNA-N | | SMILES | [C@@H](N)(C(=O)OC)CCCNC(=N)N.Cl.Cl |&1:0,r| | | CAS DataBase Reference | 26340-89-6(CAS DataBase Reference) | | EPA Substance Registry System | L-Arginine, methyl ester, dihydrochloride (26340-89-6) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29252900 | | Storage Class | 11 - Combustible Solids |
| | Methyl L-argininate dihydrochloride Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | L-Arginine methyl ester is a protected form of L-Arginine (A769505). L-Arginine is an conditionally essential amino acid for humans and adult mammals as it’s requirements exceed production during certain developmental stages in life (such as pregnancy). L-Arginine also prevents blood toxicity from intravenous amino acid administration in humans. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | a1. 100L of anhydrous ethanol was added to a pre-dried 300L reactor, cooled down to -5 to -10??C by passing ice brine, and 13L of dichlorosulfoxide was added dropwise. b1. 21.5kg of Arg.HCl of D-type was added, ice brine was turned off, and the reaction was naturally warmed up to room temperature for 24 hours. c1. Warmed up to 35??C reaction, TLC spot plate to follow the reaction, reaction ended about 48h. d1.Concentration: at the end of the reaction, concentrated under reduced pressure to obtain L-arginine methyl ester dihydrochloride intermediate in oil form. |
| | Methyl L-argininate dihydrochloride Preparation Products And Raw materials |
|