|
|
| | 5-CHLORO-2-METHOXYBENZONITRILE Basic information |
| | 5-CHLORO-2-METHOXYBENZONITRILE Chemical Properties |
| Melting point | 96 °C | | Boiling point | 267℃ | | density | 1.25 | | Fp | 115℃ | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline powder | | color | Cream | | Water Solubility | Insoluble in water. | | BRN | 3245801 | | InChI | InChI=1S/C8H6ClNO/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4H,1H3 | | InChIKey | LREABOKKLIVXNA-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(Cl)=CC=C1OC | | CAS DataBase Reference | 55877-79-7(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 5-CHLORO-2-METHOXYBENZONITRILE Usage And Synthesis |
| Uses | It is employed as an intermediate for pharmaceutical. |
| | 5-CHLORO-2-METHOXYBENZONITRILE Preparation Products And Raw materials |
|