|
|
| | DL-4-HYDROXYPHENYLGLYCINE Basic information |
| Product Name: | DL-4-HYDROXYPHENYLGLYCINE | | Synonyms: | DL-4-OH-Phg-OH;4-HYDROXY-DL-PHENYLGLYCINE;2-Amino-2-(4-hydroxyphenyl)aceticacid;(4-Hydroxyphenyl)(amino)acetic acid;2-(4-Hydroxyphenyl)glycine;2-amino-2-(4-hydroxyphenyl)acetic acid (en);4-[Amino(carboxy)methyl]phenol;4-[Amino(carboxy)methyl]phenol, Amino(4-hydroxyphenyl)acetic acid | | CAS: | 938-97-6 | | MF: | C8H9NO3 | | MW: | 167.16 | | EINECS: | 213-353-2 | | Product Categories: | pharmacetical;Pharmaceutical Intermediates;bc0001 | | Mol File: | 938-97-6.mol |  |
| | DL-4-HYDROXYPHENYLGLYCINE Chemical Properties |
| Melting point | 229-230 °C | | Boiling point | 365.8±32.0 °C(Predicted) | | density | 1.396±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Very Slightly, Heated), Water (Slightly, Heated, Sonicated) | | form | Solid | | pka | 2.15±0.10(Predicted) | | color | White to Pale Yellow | | InChI | InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12) | | InChIKey | LJCWONGJFPCTTL-UHFFFAOYSA-N | | SMILES | C(C1C=CC(O)=CC=1)(N)C(=O)O | | CAS DataBase Reference | 938-97-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2918290090 |
| | DL-4-HYDROXYPHENYLGLYCINE Usage And Synthesis |
| Chemical Properties | Type R (i.e. D): crystalline, melting point 240°C (decomposition), [α]-158.4° (C=1,1 mol/L HCl). (+/-) type: lamellar crystals (water), insoluble in water, insoluble in ether, 200°C non-melting decomposition. | | Uses | (4-Hydroxyphenyl)glycine, is a key intermediate for the synthesis Cefpiramide (C243400), used as a β-lactam antibiotic. | | Uses | 4-hydroxyphenylglycine is used (now only rarely) as a photographic developer and in
the determination of phosphorus and silicon. | | Definition | ChEBI: 4-hydroxyphenylglycine is a glycine molecule carrying a 4-hydroxyphenyl substituent. It has a role as a bacterial metabolite. It is functionally related to a glycine. | | Synthesis Reference(s) | Journal of the American Chemical Society, 93, p. 2897, 1971 DOI: 10.1021/ja00741a013 |
| | DL-4-HYDROXYPHENYLGLYCINE Preparation Products And Raw materials |
|