|
|
| | 4-AMINONONAFLUOROBIPHENYL Basic information |
| Product Name: | 4-AMINONONAFLUOROBIPHENYL | | Synonyms: | 4-AMINONONAFLUOROBIPHENYL;2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)aniline;4-Aminononafluorobiphenyl 96%;4-Aminononafluorobiphenyl96%;4-AMINONOAFLUOROBIPHENYL;2,2',3,3',4',5,5',6,6'-Nonafluorobiphenyl-4-amine, 4-Amino-2,2',3,3',4',5,5',6,6'-nonafluorobiphenyl;Perfluoro-4-aminobiphenyl 96%;Perfluoro-4-aminobiphenyl96% | | CAS: | 969-25-5 | | MF: | C12H2F9N | | MW: | 331.14 | | EINECS: | | | Product Categories: | Biphenyl derivatives | | Mol File: | 969-25-5.mol |  |
| | 4-AMINONONAFLUOROBIPHENYL Chemical Properties |
| Melting point | 146 °C | | Boiling point | 242.9±35.0 °C(Predicted) | | density | 1.699±0.06 g/cm3(Predicted) | | solubility | soluble in Toluene | | form | powder to crystal | | pka | -0.69±0.21(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C12H2F9N/c13-3-1(4(14)8(18)9(19)7(3)17)2-5(15)10(20)12(22)11(21)6(2)16/h22H2 | | InChIKey | DVKUPHGYOMHVDR-UHFFFAOYSA-N | | SMILES | C1(C2=C(F)C(F)=C(F)C(F)=C2F)=C(F)C(F)=C(N)C(F)=C1F | | CAS DataBase Reference | 969-25-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2922290090 |
| | 4-AMINONONAFLUOROBIPHENYL Usage And Synthesis |
| | 4-AMINONONAFLUOROBIPHENYL Preparation Products And Raw materials |
| Raw materials | 1,1'-Biphenyl, 2,2',3,3',4,5,5',6,6'-nonafluoro-4'-nitro--->Decafluorobiphenyl-->PENTAFLUORONITROBENZENE-->Bromopentafluorobenzene |
|