| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:TriMethylaMine-d9 Hydrochloride
CAS:18856-86-5
Package:100Mg,10Mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:TriMethyl-d9-aMine HCl
CAS:18856-86-5
Remarks:CS-C-02904
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Trimethyl-d9-amine hydrochloride
CAS:18856-86-5
Purity:99 atom % D Package:5G Remarks:613843-5G
|
|
| | TRIMETHYL-D9-AMINE HCL Basic information |
| Product Name: | TRIMETHYL-D9-AMINE HCL | | Synonyms: | N,N-DiMethylMethanaMine-d9 Hydrochloride;TriMethylaMine-d9 Hydrochloride;1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine:hydrochloride;TRIMETHYL-D9-AMINE HCL;TRIMETHYL-D9-AMINE HYDROCHLORIDE;TRIMETHYL-D9-AMMONIUM HYDROCHLORIDE;Trimethyl-d?-amine hydrochloride;Trimethyl-d9-amine hydrochloride | | CAS: | 18856-86-5 | | MF: | C3HClD9N | | MW: | 104.63 | | EINECS: | | | Product Categories: | Alphabetical Listings;Stable Isotopes | | Mol File: | 18856-86-5.mol |  |
| | TRIMETHYL-D9-AMINE HCL Chemical Properties |
| Melting point | 283-284 °C(lit.) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | 1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H/i1D3,2D3,3D3; | | InChIKey | SZYJELPVAFJOGJ-KYRNGWDOSA-N | | SMILES | Cl.[2H]C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | TRIMETHYL-D9-AMINE HCL Usage And Synthesis |
| Chemical Properties | TRIMETHYL-D9-AMINE HCL is White Solid | | Uses | TRIMETHYL-D9-AMINE HCL is a versatile building block used in the synthesis of various compounds ranging from cholines, plant growth regulators, strongly basic anion exchange resins, d ye leveling agents as well as a number of basic dyes. | | Uses | Labelled Trimethylamine. Trimethylamine is a versatile building block used in the synthesis of various compounds ranging from cholines, plant growth regulators, strongly basic anion exchange resins, dye leveling agents as well as a number of basic dyes. |
| | TRIMETHYL-D9-AMINE HCL Preparation Products And Raw materials |
|