|
|
| | 6-Carboxytetramethylrhodamine succinimidyl ester Basic information |
| Product Name: | 6-Carboxytetramethylrhodamine succinimidyl ester | | Synonyms: | 6-TAMRA, SE [6-Carboxytetramethylrhodamine, succinimidyl ester] *Single isomer*;6-Carboxy-tetramethylrhodamine N-succinimidyl ester, for fluorescence;6-CARBOXYTETRAMETHYLRHODAMINE, SUCCINIMIDE ESTER;6-CARBOXYTETRAMETHYLRHODAMINE, SUCCINIMIDYL ESTER;6-TAMRA SE;6-TAMRA-SEor6-TAMRA-NHS;2-(6-(Dimethylamino);-3-(dimethyliminio) | | CAS: | 150810-69-8 | | MF: | C29H25N3O7 | | MW: | 527.53 | | EINECS: | | | Product Categories: | FLUOROPHORES | | Mol File: | 150810-69-8.mol |  |
| | 6-Carboxytetramethylrhodamine succinimidyl ester Chemical Properties |
| storage temp. | −20°C | | solubility | DMF: soluble | | form | Solid | | color | Dark purple to black | | Appearance | Purple solid | | ex/em | 550/576 nm (MeOH/PBS) | | ε(extinction coefficient) | 90000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.1 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChIKey | PAOQTZWNYMMSEE-UHFFFAOYSA-N | | SMILES | C(C1C=CC(=CC=1C1=C2C=CC(=CC2=[O+]C2C=C(C=CC1=2)N(C)C)N(C)C)C(=O)ON1C(CCC1=O)=O)(=O)[O-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 6-Carboxytetramethylrhodamine succinimidyl ester Usage And Synthesis |
| Description | TAMRA (tetramethylrhodamine) is a xanthene dye with a fluorescence maximum at 567 nm.
This product is an N-Hydroxysuccinimide (NHS)-ester of TAMRA dye. Pure 6-isomer. TAMRA NHS-ester readily reacts with various amines and is used to generate fluorescently labeled proteins, peptides, antibodies, and other biomolecules. | | Chemical Properties | Appearance: Purple solid
ex/em: 550/576 nm (MeOH/PBS)
Extinction coefficient (ε): 90000 Lmol1cm1
Quantum yield (Φ): 0.1 | | Uses | Amine-reactive form of 6-Carboxytetramethylrhodamine succinimidyl ester used for labeling of peptides and aminoglycoside antibiotics. It is also most commonly used in automated DNA sequencing. | | Uses | 6-TAMRA SE is a fluorescent indicator. | | Abs/Em Maxima | 541/567 nm | | Fluoresene quantum yield | 0.1 | | Extinction Coefficient | 84000 | | CF260 | 0.34 | | CF280 | 0.17 |
| | 6-Carboxytetramethylrhodamine succinimidyl ester Preparation Products And Raw materials |
|