| Company Name: |
Alta Scientific Co., Ltd. Gold
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Dimethoate-d6 CAS:1219794-81-6 Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:DiMethoate-d6 CAS:1219794-81-6 Package:2.5Mg,25Mg
|
DIMETHOATE-D6 (O,O-DIMETHYL-D6) manufacturers
|
| | DIMETHOATE-D6 (O,O-DIMETHYL-D6) Basic information |
| | DIMETHOATE-D6 (O,O-DIMETHYL-D6) Chemical Properties |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic, Moisture Sensitive | | Major Application | agriculture environmental | | InChI | InChI=1S/C5H12NO3PS2/c1-6-5(7)4-12-10(11,8-2)9-3/h4H2,1-3H3,(H,6,7)/i2D3,3D3 | | InChIKey | MCWXGJITAZMZEV-XERRXZQWSA-N | | SMILES | O(C([2H])([2H])[2H])P(=S)(SCC(=O)NC)OC([2H])([2H])[2H] |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Chronic 2 |
| | DIMETHOATE-D6 (O,O-DIMETHYL-D6) Usage And Synthesis |
| Uses | A labelled organophosphate insecticide. It is an anticholinesterase which disables cholinesterase, an enzyme essential for central nervous system function. Neurotoxic in humans. |
| | DIMETHOATE-D6 (O,O-DIMETHYL-D6) Preparation Products And Raw materials |
|