- Methyl 2-Fluoroacrylate
-
- $30.00
-
2022-09-27
- CAS:2343-89-7
- Min. Order: 1Kg
- Purity: 99.0% up
- Supply Ability: 50 tons per month
|
| | METHYL 2-FLUOROACRYLATE Basic information |
| Product Name: | METHYL 2-FLUOROACRYLATE | | Synonyms: | METHYL 2-FLUOROACRYLATE;Methyl fluoroacrylate;2-Propenoic acid, 2-fluoro-, methyl ester;Methyl 2-fluoroprop-2-enoate;Methyl 2-fluoroacrylate, BHT stablized;2-FLUOROPROPENOIC ACID METHYL ESTER;2-Fluoroacrylic acid methyl ester;α-Fluoroacrylic acid methyl ester | | CAS: | 2343-89-7 | | MF: | C4H5FO2 | | MW: | 104.08 | | EINECS: | 607-233-2 | | Product Categories: | Building Blocks/Intermediates;monomer | | Mol File: | 2343-89-7.mol |  |
| | METHYL 2-FLUOROACRYLATE Chemical Properties |
| Boiling point | 41°C | | density | 1,114 g/cm3 | | vapor pressure | 70.6hPa at 25℃ | | refractive index | 1.39 | | storage temp. | 2-8°C | | form | Liquid | | color | Colorless to Almost colorless | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C4H5FO2/c1-3(5)4(6)7-2/h1H2,2H3 | | InChIKey | ZTZJVAOTIOAZGZ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(F)=C | | LogP | 0.931 at 25℃ and pH6.3 | | Surface tension | 71.5mN/m at 1g/L and 20.4℃ |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36-24/25 | | RIDADR | 1993 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | Ⅱ | | HS Code | 29161290 |
| | METHYL 2-FLUOROACRYLATE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Methyl 2-fluoroacrylate is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. | | Synthesis Reference(s) | Synthetic Communications, 11, p. 901, 1981 DOI: 10.1080/00397918108065745 | | Synthesis | METHYL 2-FLUOROACRYLATE can be produced through DMPU/HF/Au-l Fluorination System. The DMPU-HF complex is reported to be acidic enough to activate the imidogold precatalyst (Au-1). In the monohydrofluorination of acceptor substituted terminal alkyne, the DMPU-HF-Au system was found to yield a reversed Michael addition product as the only regio-isomer with good yield.
 |
| | METHYL 2-FLUOROACRYLATE Preparation Products And Raw materials |
|