|
|
| | CYCLOPENTYL PHENYL KETONE Basic information |
| | CYCLOPENTYL PHENYL KETONE Chemical Properties |
| Boiling point | 136-140°C 16mm | | density | 1,036 g/cm3 | | refractive index | 1.5440 | | Fp | >110°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol (Slightly) | | form | Oil | | color | Pale Yellow | | Specific Gravity | 1.04 | | BRN | 2045903 | | Major Application | pharmaceutical | | InChI | InChI=1S/C12H14O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 | | InChIKey | VYDIMQRLNMMJBW-UHFFFAOYSA-N | | SMILES | C(C1CCCC1)(C1=CC=CC=C1)=O | | CAS DataBase Reference | 5422-88-8(CAS DataBase Reference) | | EPA Substance Registry System | Methanone, cyclopentylphenyl- (5422-88-8) |
| Safety Statements | 23-24/25 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2914.39.9000 | | Storage Class | 10 - Combustible liquids |
| Provider | Language |
|
ALFA
| English |
| | CYCLOPENTYL PHENYL KETONE Usage And Synthesis |
| Description | Phenyl cyclopentyl ketone (Item No. 31036) is an analytical reference standard categorized as a precursor in the synthesis of ketamine (Item Nos. 19389 | 11630). This product is intended for research and forensic applications. | | Uses | Phenylcyclopentyl ketone is the key intermediate of synthetic hydrochloric acid amyl ethyl quin ether. | | Uses | Cyclopentyl Phenyl Ketone is used in the preparation of ortho-arylated compounds and phenanthrones by palladium-catalyzed chelation-assisted C-H activation of Cyclopentyl Phenyl Ketone. | | Synthesis | In 100ml round-bottomed flask, by 2-cyclopenta ethyl benzoylacetate (10.6g, 43.05mmol, 1.0eq), NaOH (2.6g, 64.5mmol) and Na2CO3(4.5g, 43mmol), is suspended in 50.0mLH2In O, it is warmed up to 80°C and reacts 3 hours, obtain product phenylcyclopentyl ketone.Purify: reactant liquor is cooled to room temperature, extract 3 times with ethyl acetate 20mL；Organic phase saturated sodium-chloride washs, and merges organic phase and uses anhydrous MgSO4Being dried, then remove solvent under reduced pressure, obtain thick product, column chromatography purifies, and eluant, eluent is ethyl acetate: petroleum ether (1:10), obtains 6.54g target product, yield 87.2%. |
| | CYCLOPENTYL PHENYL KETONE Preparation Products And Raw materials |
|