|
|
| | Boc-L-Histidine(Tosyl) Basic information |
| | Boc-L-Histidine(Tosyl) Chemical Properties |
| Melting point | ~125 °C (dec.) | | density | 1.19 | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.50±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +16±1°, c = 1% in methanol | | BRN | 769957 | | Major Application | peptide synthesis | | InChI | 1S/C18H23N3O6S/c1-12-5-7-14(8-6-12)28(25,26)21-10-13(19-11-21)9-15(16(22)23)20-17(24)27-18(2,3)4/h5-8,10-11,15H,9H2,1-4H3,(H,20,24)(H,22,23)/t15-/m0/s1 | | InChIKey | DCLJSEPKYJSEHW-HNNXBMFYSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)n2cnc(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)c2 | | CAS DataBase Reference | 35899-43-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29350090 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-L-Histidine(Tosyl) Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powde | | Uses | Boc-L-His(Tos)-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-Histidine(Tosyl) Preparation Products And Raw materials |
|