|
|
| | 2,6-Naphthalenedisulfonic acid disodium salt Basic information |
| | 2,6-Naphthalenedisulfonic acid disodium salt Chemical Properties |
| Melting point | >300 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C10H8O6S2.Na.H/c11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9;;/h1-6H,(H,11,12,13)(H,14,15,16);; | | InChIKey | IKKMQYQNEWIQCQ-UHFFFAOYSA-N | | SMILES | S(C1C=CC2=CC(S(O)(=O)=O)=CC=C2C=1)(O)(=O)=O.[NaH] | | CAS DataBase Reference | 1655-45-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2904100090 | | Storage Class | 11 - Combustible Solids |
| | 2,6-Naphthalenedisulfonic acid disodium salt Usage And Synthesis |
| Chemical Properties | White powder |
| | 2,6-Naphthalenedisulfonic acid disodium salt Preparation Products And Raw materials |
|