DITHIOPYR manufacturers
- DITHIOPYR
-
- $1.00 / 1KG
-
2020-02-19
- CAS:97886-45-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | DITHIOPYR Basic information |
| Product Name: | DITHIOPYR | | Synonyms: | DIMENSION;DICTRAN;DITHIOPYR;3,5-pyridinedicarbothioicacid,2-(difluoromethyl)-4-(2-methylpropyl)-6-(triflu;mon15100;mon7200;oromethyl)-,s,s-dimethylester;Dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3,5-pyridinedicarbothioate | | CAS: | 97886-45-8 | | MF: | C15H16F5NO2S2 | | MW: | 401.42 | | EINECS: | | | Product Categories: | | | Mol File: | 97886-45-8.mol |  |
| | DITHIOPYR Chemical Properties |
| Melting point | 65° | | Boiling point | 460.3±45.0 °C(Predicted) | | density | 1.3583 (estimate) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | -7.10±0.50(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C15H16F5NO2S2/c1-6(2)5-7-8(13(22)24-3)10(12(16)17)21-11(15(18,19)20)9(7)14(23)25-4/h6,12H,5H2,1-4H3 | | InChIKey | YUBJPYNSGLJZPQ-UHFFFAOYSA-N | | SMILES | C1(CC(C)C)=C(C(=O)SC)C(=NC(C(F)(F)F)=C1C(=O)SC)C(F)F | | EPA Substance Registry System | Dithiopyr (97886-45-8) |
| | DITHIOPYR Usage And Synthesis |
| Uses | Herbicide. | | Uses | Dimension can be employed as a herbicide. | | Definition | ChEBI: Dithiopyr is a member of pyridines, a thioester and an organofluorine compound. |
| | DITHIOPYR Preparation Products And Raw materials |
|