|
|
| | 2-METHOXY-2,4-DIPHENYL-3(2H)-FURANONE Basic information |
| | 2-METHOXY-2,4-DIPHENYL-3(2H)-FURANONE Chemical Properties |
| Melting point | 96°C | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | BRN | 1288529 | | InChI | 1S/C17H14O3/c1-19-17(14-10-6-3-7-11-14)16(18)15(12-20-17)13-8-4-2-5-9-13/h2-12H,1H3 | | InChIKey | BLWINLJDTOJSRU-UHFFFAOYSA-N | | SMILES | COC1(OC=C(C1=O)c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2932.19.1000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-METHOXY-2,4-DIPHENYL-3(2H)-FURANONE Usage And Synthesis |
| Uses | 2-Methoxy-2,4-diphenyl-3(2H)-furanone (cas# 50632-57-0) is a compound useful in organic synthesis. | | Uses | 2-Methoxy-2,4-diphenyl-3(2H)-furanone (MDPF) is used as a fluorescence reagent to derivatize primary and secondary amines on molecules such as proteins. MDPF derivatized molecules can be detected during analytical and separation procedures including chromatography, electrophoresis and zymography. |
| | 2-METHOXY-2,4-DIPHENYL-3(2H)-FURANONE Preparation Products And Raw materials |
|