|
|
| | 2,3,4,5,6-PENTAFLUOROSTYRENE Basic information |
| Product Name: | 2,3,4,5,6-PENTAFLUOROSTYRENE | | Synonyms: | PENTAFLUOROSTYRENE;2',3',4',5',6'-PENTAFLUOROSTYRENE;2,3,4,5,6-PENTAFLUOROSTYRENE;2,3,4,5,6-PENTAFLUOROVINYLBENZENE;1,2,3,4,5-Pentafluoro-6-vinylbenzene;Styrene, 2,3,4,5,6-pentafluoro-;Vinylpentafluorobenzene;2',3',4',5',6'-Pentafluorostyrene 99% | | CAS: | 653-34-9 | | MF: | C8H3F5 | | MW: | 194.1 | | EINECS: | 211-500-5 | | Product Categories: | Monomers;Polymer Science;Styrene and Functionalized Styrene Monomers;Alkenyl;Halogenated Hydrocarbons;Organic Building Blocks;monomer | | Mol File: | 653-34-9.mol |  |
| | 2,3,4,5,6-PENTAFLUOROSTYRENE Chemical Properties |
| Boiling point | 62-63 °C/50 mmHg (lit.) | | density | 1.406 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.446(lit.) | | Fp | 94 °F | | storage temp. | -20°C | | form | Liquid | | Specific Gravity | 1.432 | | color | Clear colorless to yellow | | Water Solubility | Immiscible with water. | | BRN | 1874390 | | Stability: | Flammable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C8H3F5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 | | InChIKey | LVJZCPNIJXVIAT-UHFFFAOYSA-N | | SMILES | C1(C=C)=C(F)C(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 653-34-9(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 10 | | Safety Statements | 23-24/25-16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable/Keep Cold | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2,3,4,5,6-PENTAFLUOROSTYRENE Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | 2,3,4,5,6-Pentafluorostyrene is used in the synthesis of optically active copolymers having low surface energies by utilizing beta-pinene as another monomer. It is also used in the synthesis of fluorinated and photo crosslinkable liquid prepolymers, which is used for flexible optical waveguides. Polymeric fluorinated nano particles prepared using 2,3,4,5,6-Pentafluorostyrene and styrene is explored in magnetic resonance image (MRI) applications, since it has larger structural design potential compared to traditional systems like emulsions and solutions of smaller molecules. | | Uses | Copolymers of 2,3,4,5,6-Pentafluorostyrene and N-phenylmaleimide were synthesized by free radical polymerization. Diblock copolymers of D,L-lactide and pentafluorostyrene with narrow molecular weight distributions have been reported. Fluorinated and photocrosslinkable liquid prepolymers have been synthesized for flexible optical waveguides, the prepolymers are photocurable to afford flexible and transparent films. Phase copolymers consisting of poly(methylmethacrylate) (p-MMA)/n-butylacrylate (nBA) and poly(nBA)/pentafluorostyrene (p-PFS)have been prepared. | | General Description | 2,3,4,5,6-Pentafluorostyrene is a fluorinated monomer. |
| | 2,3,4,5,6-PENTAFLUOROSTYRENE Preparation Products And Raw materials |
| Raw materials | 1,2,3,4,5-Pentafluoro-6-ethylbenzene-->Benzene, 1-(2-bromoethyl)-2,3,4,5,6-pentafluoro--->2-(PENTAFLUOROPHENYL)ETHANOL-->1-(PENTAFLUOROPHENYL)ETHANOL, 97-->PENTAFLUOROPHENYL TRIFLUOROMETHANESULFONATE-->2,3,4,5,6-PENTAFLUOROCINNAMIC ACID-->2',3',4',5',6'-PENTAFLUOROACETOPHENONE-->Pentafluorobenzaldehyde-->Phosphonium, methyltriphenyl-, inner salt-->Tributyl(vinyl)tin-->Vinyl bromide-->IODOPENTAFLUOROBENZENE-->Ethylene-->Pentafluorobenzene-->Acetylene-->Benzoic acid | | Preparation Products | 4-Hydroxy-2,3,5,6-tetrafluorostyrene |
|