|
|
| | Ethyltriphenylphosphonium iodide Basic information |
| | Ethyltriphenylphosphonium iodide Chemical Properties |
| Melting point | 164-168 °C(lit.) | | Boiling point | 337 °C | | density | 1.500 | | vapor pressure | 0Pa at 25℃ | | Fp | 226 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Acetone, Chloroform, Dichloromethane, Methanol | | form | Powder | | color | Yellow | | Water Solubility | slightly soluble | | Sensitive | Light Sensitive & Hygroscopic | | BRN | 3659323 | | InChI | 1S/C20H20P.HI/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h3-17H,2H2,1H3;1H/q+1;/p-1 | | InChIKey | SLAFUPJSGFVWPP-UHFFFAOYSA-M | | SMILES | [I-].CC[P+](c1ccccc1)(c2ccccc2)c3ccccc3 | | LogP | 0.324 | | CAS DataBase Reference | 4736-60-1(CAS DataBase Reference) | | EPA Substance Registry System | Phosphonium, ethyltriphenyl-, iodide (4736-60-1) |
| Hazard Codes | T,Xn | | Risk Statements | 25-36/38-21-36/37/38-20/21/22 | | Safety Statements | 45-36/37/39-28A-26-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | TA2312000 | | F | 3-8-10 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29310095 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 |
| | Ethyltriphenylphosphonium iodide Usage And Synthesis |
| Chemical Properties | Ethyltriphenylphosphonium iodide is white to slightly yellowish crystalline powder | | Uses | Ethyltriphenylphosphonium iodide is used as a Wittig reagent and phase transfer catalyst in organic synthesis. It can also be used in asymmetric hydrogenation and to make Bismuth(III) polynuclear complexes. | | Uses | Ethyltriphenylphosphonium iodide is involved in synthesis of diarylmethine derivatives, phosphonium salts, and bismuth(III) polynuclear halide complexes, asymmetric hydrogenation. | | Flammability and Explosibility | Not classified | | reaction suitability | reaction type: C-C Bond Formation |
| | Ethyltriphenylphosphonium iodide Preparation Products And Raw materials |
|