|
|
| | 1-Bromo-4-cyclohexylbenzene Basic information |
| Product Name: | 1-Bromo-4-cyclohexylbenzene | | Synonyms: | 1-BROMO-4-CYCLOHEXYLBENZENE;4-BROMOPHENYLCYCLOHEXANE;p-bromophenylcyclohexane;4-Bromo-1-cyclohexylbenzene;Ai3-11173;Benzene, 1-bromo-4-cyclohexyl-;Einecs 246-623-3;4-Cyclohexylbromobenzene | | CAS: | 25109-28-8 | | MF: | C12H15Br | | MW: | 239.15 | | EINECS: | 246-623-3 | | Product Categories: | | | Mol File: | 25109-28-8.mol |  |
| | 1-Bromo-4-cyclohexylbenzene Chemical Properties |
| Boiling point | 90-94°C 0,01mm | | density | 1,287 g/cm3 | | refractive index | 1.5595 | | Fp | 90-94°C/0.01mm | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | Not miscible or difficult to mix with water. | | BRN | 2209869 | | InChI | InChI=1S/C12H15Br/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2 | | InChIKey | LVIJLEREXMVRAN-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(C2CCCCC2)C=C1 | | CAS DataBase Reference | 25109-28-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 29039990 |
| Provider | Language |
|
ALFA
| English |
| | 1-Bromo-4-cyclohexylbenzene Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses | 1-Bromo-4-cyclohexylbenzene is used as a organic light-emitting diode and as a pharmaceutical intermediate. |
| | 1-Bromo-4-cyclohexylbenzene Preparation Products And Raw materials |
|