| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Citric acid-13C6
CAS:287389-42-8
Purity:99 atom % 13C, 97% (CP) Package:100MG Remarks:606081-100MG
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:CITRIC ACID-13C6
CAS:287389-42-8
Purity:科研试剂 Package:100mg Remarks:B71677
|
| Company Name: |
Qingdao Tenglong microwave technology co., LTD.
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:CITRIC ACID (13C6, 99%) CHEMICAL PURITY 97%
CAS:287389-42-8
Purity:98% Package:询问 Remarks:CLM-9021-PK
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Citric acid-13C6 99 atom % 13C, 97% (CP)
CAS:287389-42-8
Purity:97% (CP) Package:100mg Remarks:NULL
|
|
| | CITRIC ACID-13C6 Basic information |
| | CITRIC ACID-13C6 Chemical Properties |
| Melting point | 153-159 °C (lit.) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | KRKNYBCHXYNGOX-IDEBNGHGSA-N | | SMILES | O[13C](=O)[13CH2][13C](O)([13CH2][13C](O)=O)[13C](O)=O | | CAS Number Unlabeled | 77-92-9 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
STOT SE 3 |
| | CITRIC ACID-13C6 Usage And Synthesis |
| Uses | Citric Acid-13C6 is an isotope labelled compound of citric acid (C521000). Citric acid is mainly used as an acidifier, flavoring agent and chelating agent. Citric acid is also a metabolite of Dimethyl Fumarate (D464965), a compound used as a treatment for the relapsing forms of multiple sclerosis and psoriasis. |
| | CITRIC ACID-13C6 Preparation Products And Raw materials |
|