| Company Name: |
Shanghai Tauto Biotech Co., Ltd.
|
| Tel: |
021-51320588 |
| Email: |
tauto@tautobiotech.com |
| Products Intro: |
Product Name:PRIMVERIN(SH)
CAS:154-60-9
Purity:NLT 95% HPLC Package:10Mg;20Mg;50Mg;100Mg to graMs.Not More than tens of graMs. Remarks:ASB-00016212-010
|
| Company Name: |
Biyu Biotechnology (Shanghai) Co., ltd
|
| Tel: |
021-26018599 |
| Email: |
|
| Products Intro: |
Product Name:PRIMVERIN
CAS:154-60-9
Purity:>99.0 % Package:10mg,50mg,100mg,500mg,or as request Remarks:BY70189
|
| Company Name: |
EMMX Biotechnology LLC
|
| Tel: |
888-539-0666 |
| Email: |
info@emmx.com |
| Products Intro: |
Product Name:Primverin
CAS:154-60-9
Purity:98% HPLC Package:5mg;10mg;25mg;50mg;100mg;250mg;500mg;1g
|
PRIMVERIN manufacturers
- PRIMVERIN
-
- $0.00 / 1KG
-
2025-12-24
- CAS:154-60-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
|
| | PRIMVERIN Basic information |
| Product Name: | PRIMVERIN | | Synonyms: | PRIMVERIN(P);PRIMULAVERIN(SH);PriMeverin;PriMveroside;4-Methoxy-2-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]benzoic acid methyl ester;PRIMVERIN;HPLCgrade;4-methoxy-2-β-primverosyloxy-benzoic acid methyl ester | | CAS: | 154-60-9 | | MF: | C20H28O13 | | MW: | 476.42852 | | EINECS: | | | Product Categories: | | | Mol File: | 154-60-9.mol |  |
| | PRIMVERIN Chemical Properties |
| Melting point | 206℃ | | Boiling point | 747.1±60.0 °C(Predicted) | | density | 1.56±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | pka | 12.75±0.70(Predicted) | | form | solid | | InChIKey | DZRVGBRAMLSZDQ-HSMQXHTESA-N | | SMILES | COC(=O)c1ccc(OC)cc1O[C@@H]2O[C@H](CO[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | PRIMVERIN Usage And Synthesis |
| | PRIMVERIN Preparation Products And Raw materials |
|