- 4-Propylbenzoic acid
-
- $0.00 / 25KG
-
2026-05-14
- CAS:2438-05-3
- Min. Order: 1KG
- Purity: ≥99.5%
- Supply Ability: 100mt/year
- 4-Propylbenzoic acid
-
- $2.00 / 100kg
-
2026-04-17
- CAS:2438-05-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- 4-Propylbenzoic acid
-
- $0.00 / 1KG
-
2025-06-27
- CAS:2438-05-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | 4-Propylbenzoic acid Basic information |
| | 4-Propylbenzoic acid Chemical Properties |
| Melting point | 142-144 °C (lit.) | | Boiling point | 288.61°C (estimate) | | density | 1.0670 (estimate) | | refractive index | 1.5198 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | very faint turbidity in Methanol | | pka | 4.37±0.10(Predicted) | | form | Needles or Crystalline Powder | | color | White to yellow | | BRN | 1934550 | | InChI | InChI=1S/C10H12O2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h4-7H,2-3H2,1H3,(H,11,12) | | InChIKey | ATZHGRNFEFVDDJ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(CCC)C=C1 | | CAS DataBase Reference | 2438-05-3(CAS DataBase Reference) | | NIST Chemistry Reference | 4-N-propylbenzoic acid(2438-05-3) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids |
| | 4-Propylbenzoic acid Usage And Synthesis |
| Chemical Properties | white to yellow needles or crystalline powder | | Uses | 4-Propylbenzoic acid was used in the preparation of [2,7-dimethoxy-8-(4-propylbenzoyl)naphthalen-1-yl](4-propylphenyl)-methanone. | | Definition | ChEBI: 4-propylbenzoic acid is an alkylbenzene. |
| | 4-Propylbenzoic acid Preparation Products And Raw materials |
|