| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Atrazine-d5 CAS:163165-75-1 Package:10Mg,1Mg
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Atrazine D5 (ethylaMino D5) CAS:163165-75-1 Purity:98% Package:10Mg 25Mg 100Mg
|
| Company Name: |
Chengdu RunZeBenTu Chemical Co., Ltd
|
| Tel: |
13096311329 028-88469284 616445927 |
| Email: |
616445927@qq.com |
| Products Intro: |
Product Name:ATRAZINE D5 CAS:163165-75-1 Package:5g/25g/100g/250g/500g
|
|
| | ATRAZINE D5 Basic information |
| | ATRAZINE D5 Chemical Properties |
| Melting point | 171-174°C | | storage temp. | 0-6°C | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | White to off-white | | Major Application | agriculture environmental | | InChI | 1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14)/i1D3,4D2 | | InChIKey | MXWJVTOOROXGIU-SGEUAGPISA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])Nc1nc(Cl)nc(NC(C)C)n1 | | EPA Substance Registry System | 1,3,5-Triazine-2,4-diamine, 6-chloro-N-(ethyl-d5)-N'-(1-methylethyl)- (163165-75-1) |
| Hazard Codes | Xn,N | | Risk Statements | 43-48/22-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT RE 2 Oral |
| | ATRAZINE D5 Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Labelled selective herbicide. Potential symptoms of overexposure are irritation of eyes and skin; dermatitis, skin sensitization; dyspnea, weakness, incoordination, salivation; hypothermia; liver injury |
| | ATRAZINE D5 Preparation Products And Raw materials |
|