| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride Basic information |
| Product Name: | 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride | | Synonyms: | Buclizine HCl IMpurity-A(BP/EP);1,4-Bis[^a-(4-chlorophenyl)benzyl]piperazine dihydrochloride, 97%;Cetirizine IMpurity D;Piperazine, 1,4-bis[(4- chlorophenyl)phenylMethyl]-;1,4-Bis[alpha-(4-chlorophenyl)benzyl]piperazine dihydrochloride;Cetirizine Dihydrochloride impurity D;1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine DiHCl;Cetirizine Impurity 12 | | CAS: | 346451-15-8 | | MF: | C30H28Cl2N2 | | MW: | 487.46 | | EINECS: | | | Product Categories: | Aromatics, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 346451-15-8.mol | ![1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride Structure](CAS/GIF/346451-15-8.gif) |
| | 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride Chemical Properties |
| Melting point | >180°C (dec.) | | Boiling point | 270-275 °C(Press: 1 Torr) | | density | 1.228±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly, Heated, Sonicated), DMSO (Slightly, Heated), Methanol (Slightly) | | pka | 5.85±0.10(Predicted) | | form | Solid | | color | White | | Stability: | Hygroscopic | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | 1S/C30H28Cl2N2.2ClH/c31-27-15-11-25(12-16-27)29(23-7-3-1-4-8-23)33-19-21-34(22-20-33)30(24-9-5-2-6-10-24)26-13-17-28(32)18-14-26;;/h1-18,29-30H,19-22H2;2*1H | | InChIKey | DLEQNCKNBPYHEY-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)C(N3CCN(CC3)C(c5ccc(cc5)Cl)c4ccccc4)c2ccccc2.Cl.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride Usage And Synthesis |
| Uses | 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine is an impurity of Buclizine (B689450), an antiemetic agent. |
| | 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride Preparation Products And Raw materials |
|