|
|
| | Tetrabutylphosphonium bromide Basic information |
| | Tetrabutylphosphonium bromide Chemical Properties |
| Melting point | 100-103 °C(lit.) | | density | 1.8[at 20℃] | | vapor pressure | 0.018Pa at 25℃ | | Fp | 290 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | crystal | | color | white | | Water Solubility | ca 70 g/100 mL | | Sensitive | Hygroscopic, Light Sensitive | | BRN | 4160474 | | Stability: | hygroscopic | | InChI | 1S/C16H36P.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 | | InChIKey | JRMUNVKIHCOMHV-UHFFFAOYSA-M | | SMILES | [Br-].CCCC[P+](CCCC)(CCCC)CCCC | | LogP | -0.44 at 23℃ | | CAS DataBase Reference | 3115-68-2(CAS DataBase Reference) | | NIST Chemistry Reference | Phosphonium bromide, tetrabutyl(3115-68-2) | | EPA Substance Registry System | Phosphonium, tetrabutyl-, bromide (3115-68-2) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 21/22-36/37/38-24-20/21/22 | | Safety Statements | 26-37/39-45-36/37/39-28A-36 | | RIDADR | UN 3464 6.1/PG 3 | | WGK Germany | 3 | | RTECS | TA2417000 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29310095 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Dam. 1
Met. Corr. 1
Repr. 2
Skin Sens. 1B | | Toxicity | mouse,LD50,intravenous,56mg/kg (56mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#03131, |
| | Tetrabutylphosphonium bromide Usage And Synthesis |
| Chemical Properties | Tetrabutylphosphonium bromide is WHITE TO CREAM CRYSTALLINE POWDER | | Uses | Tetrabutylphosphonium bromide is a useful synthetic reagent used in proteomics research. | | Uses | Tetra-n-butylphosphonium bromide is used as a phase-transfer catalyst at high temperatures, at which nitrogen analogues tend to undergo elimination e.g. as catalyst for the dealkoxycarbonylation of malonates and -keto esters by heating in stearic acid. used as an ionic liquid solvent in the regioselective O-alkylation of C/O ambident nucleophiles. It is a synthetic reagent used in proteomics research. | | Uses | Tetrabutylphosphonium bromide (TBPB) is a quaternary salt which can be used:
As a medium to disperse ruthenium catalyst for the synthesis of ethylene glycol from synthesis gas via ruthenium melt catalysis.
As a catalyst supported on silica or alumina for the halogen exchange reaction to synthesize alkyl bromide from alkyl chloride.
To synthesize various ionic liquids on mixing with different proportions of 1,3-dimethylurea for capturing NO gas.
As a hydrogen-bond acceptor along with levulinic acid as a hydrogen-bond donor for the preparation of deep eutectic solvents to separate toluene from toluene/n-hexane mixtures.
To prepare ionic semiclathrate hydrates. | | Flammability and Explosibility | Non flammable |
| | Tetrabutylphosphonium bromide Preparation Products And Raw materials |
|