|
|
| | 1-(4-Chlorophenyl)-2-nitroethene Basic information |
| | 1-(4-Chlorophenyl)-2-nitroethene Chemical Properties |
| Melting point | 112-116 °C(lit.) | | Boiling point | 299.0±15.0 °C(Predicted) | | density | 1.324±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C8H6ClNO2/c9-8-3-1-7(2-4-8)5-6-10(11)12/h1-6H/b6-5+ | | InChIKey | GLJATYFHELDGEA-AATRIKPKSA-N | | SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1ccc(Cl)cc1 | | CAS DataBase Reference | 706-07-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | RTECS | WL4200500 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 |
| | 1-(4-Chlorophenyl)-2-nitroethene Usage And Synthesis |
| | 1-(4-Chlorophenyl)-2-nitroethene Preparation Products And Raw materials |
|