|
|
| | Vinyl tris(trimethylsiloxy)silane Basic information |
| Product Name: | Vinyl tris(trimethylsiloxy)silane | | Synonyms: | 3-ethenyl-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]-trisiloxan;1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy)-3-vinyltrisiloxane;[Tris(trimethylsiloxy)silyl]ethylene, Vinyltris(trimethylsiloxy)silane;VINYLTRIS(TRIMETHYLSILOXY)SILANE;VINYLTRIS-(TRIMETHYLSILYLOXY)-SILAN;VINYLTRIS(TRIMETHYLSILYLOXY)SILANE;[TRIS-(TRIMETHYLSILYLOXY)-SILYL]-ETHYLEN;[TRIS(TRIMETHYLSILOXY)SILYL]ETHYLENE | | CAS: | 5356-84-3 | | MF: | C11H30O3Si4 | | MW: | 322.7 | | EINECS: | 226-342-2 | | Product Categories: | Acyclic;Alkenes;Building Blocks;Chemical Synthesis;Organic Building Blocks;monomer | | Mol File: | 5356-84-3.mol |  |
| | Vinyl tris(trimethylsiloxy)silane Chemical Properties |
| Boiling point | 86.5-87.5 °C/15 mmHg (lit.) | | density | 0.861 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.395(lit.) | | Fp | 150 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.8657 | | Water Solubility | insoluble | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | BRN | 1795324 | | InChI | InChI=1S/C11H30O3Si4/c1-11-18(12-15(2,3)4,13-16(5,6)7)14-17(8,9)10/h11H,1H2,2-10H3 | | InChIKey | CHEFFAKKAFRMHG-UHFFFAOYSA-N | | SMILES | [Si](C)(C)(C)O[Si](C=C)(O[Si](C)(C)C)O[Si](C)(C)C | | EPA Substance Registry System | Trisiloxane, 3-ethenyl-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]- (5356-84-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-10 | | Safety Statements | 26-36-37/39-16 | | RIDADR | 1993 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29310099 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Vinyl tris(trimethylsiloxy)silane Usage And Synthesis |
| Chemical Properties | Clear colorless liquid |
| | Vinyl tris(trimethylsiloxy)silane Preparation Products And Raw materials |
|