- Benzyl Laurate
-
- $45.00 / 1kg
-
2025-05-23
- CAS:140-25-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 tons
|
| | BENZYL LAURATE Basic information |
| Product Name: | BENZYL LAURATE | | Synonyms: | LAURIC ACID BENZYL ESTER;BENZYL DODECANOATE;BENZYL LAURATE;dodecanoicacid,benzylester;Dodecanoicacid,phenylmethylester;dodecanoicacidbenzylester;Dodecanoicacidphenylmethylester;Benzyllaurat | | CAS: | 140-25-0 | | MF: | C19H30O2 | | MW: | 290.44 | | EINECS: | 205-405-8 | | Product Categories: | | | Mol File: | 140-25-0.mol |  |
| | BENZYL LAURATE Chemical Properties |
| Melting point | 9.5 °C | | Boiling point | 211°C 12mm | | density | 0,94 g/cm3 | | refractive index | 1.4810 to 1.4830 | | Fp | 171°C | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 100.00 %. light fatty waxy soapy | | Odor Type | soapy | | Cosmetics Ingredients Functions | FRAGRANCE
SKIN CONDITIONING
SOLVENT
SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C19H30O2/c1-2-3-4-5-6-7-8-9-13-16-19(20)21-17-18-14-11-10-12-15-18/h10-12,14-15H,2-9,13,16-17H2,1H3 | | InChIKey | QNRYOQRUGRVBRL-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)CCCCCCCCCCC | | LogP | 7.093 (est) | | EPA Substance Registry System | Dodecanoic acid, phenylmethyl ester (140-25-0) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RTECS | JR3425000 | | TSCA | TSCA listed | | HS Code | 2915.90.2000 |
| | BENZYL LAURATE Usage And Synthesis |
| Uses | benzyl laurate is an emollient ester that is easily emulsified and leaves the skin feeling silky. It is non-toxic, non-irritating, nonviscous, and non-oily. It also reduces the oiliness of mineral oil and solubilizes sunscreen actives. | | Safety Profile | A skin irritant. When heated to decomposition it emits acrid smoke andirritating fumes. | | Synthesis | Benzyl laurate is prepared from Benzyl alcohol and Laurie acid (Dodecanoic acid) by direct esteritka:ion under azeotropic conditions. |
| | BENZYL LAURATE Preparation Products And Raw materials |
|