6-METHOXYKAEMPFEROL manufacturers
|
| | 6-METHOXYKAEMPFEROL Basic information |
| Product Name: | 6-METHOXYKAEMPFEROL | | Synonyms: | 6-METHOXYKAEMPFEROL;3,4',5,7-Tetrahydroxy-6-methoxyflavone;Kaempferol 6-methyl ether;6-Methoxy-3,5,7,4'-tetrahydroxyflavone;4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-6-methoxy-;Aurofusarin Impurity 2;6-Methoxykaempferol, 10 mM in DMSO;3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one | | CAS: | 32520-55-1 | | MF: | C16H12O7 | | MW: | 316.26 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 32520-55-1.mol |  |
| | 6-METHOXYKAEMPFEROL Chemical Properties |
| Boiling point | 626.7±55.0 °C(Predicted) | | density | 1.634±0.06 g/cm3(Predicted) | | pka | 6.32±0.40(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C16H12O7/c1-22-16-9(18)6-10-11(13(16)20)12(19)14(21)15(23-10)7-2-4-8(17)5-3-7/h2-6,17-18,20-21H,1H3 | | InChIKey | OGQSUSFDBWGFFJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C=C2)OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1O |
| | 6-METHOXYKAEMPFEROL Usage And Synthesis |
| Uses | 6-Methoxykaempferol is a flavone that can be found in brazilian propolis. 6-Methoxykaempferol shows anti-proliferative activity for cancer cells[1]. | | Definition | ChEBI: 3,4',5,7-Tetrahydroxy-6-methoxyflavone is a hydroxyflavan. | | References | [1] Mitsui T, et al. Chemical constituents of Brazilian Propolis from the state of Bahia and their growth inhibitory activities against cancer cells. Biosci Biotechnol Biochem. 2018 Mar;82(3):417-421. DOI:10.1080/09168451.2018.1427550 |
| | 6-METHOXYKAEMPFEROL Preparation Products And Raw materials |
|