- Cbz-L-Lys-OH
-
- $0.00/ kg
-
2026-01-23
- CAS:2212-75-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Cbz-Lys-OH
-
- $0.00 / 25Kg/Drum
-
2026-01-23
- CAS:2212-75-1
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Z-Lys-OH
-
- $29.00 / 1g
-
2026-01-15
- CAS:2212-75-1
- Min. Order:
- Purity: 99.11%
- Supply Ability: 10g
|
| | N-alpha-Cbz-L-lysine Basic information |
| | N-alpha-Cbz-L-lysine Chemical Properties |
| Melting point | 226-231 °C (dec.)(lit.) | | alpha | -13 º (c=2 in 0.2N HCl) | | Boiling point | 497.0±45.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | refractive index | 1,512 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 3.90±0.21(Predicted) | | form | Solid | | color | White | | Optical Rotation | [α]20/D 13±2°, c = 2 in 0.2 M HCl | | BRN | 2153826 | | Major Application | peptide synthesis | | InChI | 1S/C14H20N2O4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | OJTJKAUNOLVMDX-LBPRGKRZSA-N | | SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O | | CAS DataBase Reference | 2212-75-1(CAS DataBase Reference) | | EPA Substance Registry System | L-Lysine, N2-[(phenylmethoxy)carbonyl]- (2212-75-1) |
| | N-alpha-Cbz-L-lysine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Educt for the convenient preparation of L-a-aminoadipic acid. | | Uses | N2-[(Phenylmethoxy)carbonyl]-L-lysine id used in the synthesis of hydroxamic acids and mycobacterium inhibitors. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-alpha-Cbz-L-lysine Preparation Products And Raw materials |
|