|
|
| | TRIBUTYL(3-METHYL-2-BUTENYL)TIN Basic information |
| | TRIBUTYL(3-METHYL-2-BUTENYL)TIN Chemical Properties |
| Boiling point | 283 °C(lit.) | | density | 1.069 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.488(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator (+4°C) | | form | Liquid | | color | Clear colorless | | Specific Gravity | 1.069 | | Water Solubility | Immiscible with water. | | BRN | 3588742 | | InChI | 1S/C5H9.3C4H9.Sn/c1-4-5(2)3;3*1-3-4-2;/h4H,1H2,2-3H3;3*1,3-4H2,2H3; | | InChIKey | XEFRYQPTIWSVGI-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)C\C=C(\C)C |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29312000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | TRIBUTYL(3-METHYL-2-BUTENYL)TIN Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Tri-n-butyl(3-methyl-2-butenyl)tin is used in prenylation of ethyl propiolate. It is also involved in chemical research. |
| | TRIBUTYL(3-METHYL-2-BUTENYL)TIN Preparation Products And Raw materials |
|