- BOC-L-4-Methylphe
-
-
2025-04-04
- CAS:80102-26-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- BOC-L-4-Methylphe
-
- $20.00
-
2019-07-06
- CAS:80102-26-7
- Min. Order: 10KG
- Purity: 99%
- Supply Ability: 100kg
|
| | BOC-L-4-Methylphe Basic information |
| | BOC-L-4-Methylphe Chemical Properties |
| Melting point | 84-88 °C | | alpha | 30 º (c=1,EtOH) | | Boiling point | 440.4±40.0 °C(Predicted) | | density | 1.140±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.92±0.10(Predicted) | | form | solid | | color | White to off-white | | Optical Rotation | [α]20/D +16±2°, c = 1% in methanol | | Water Solubility | Slightly soluble in water. | | BRN | 5381557 | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c1-10-5-7-11(8-6-10)9-12(13(17)18)16-14(19)20-15(2,3)4/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | JYRWNPUFECDJCX-LBPRGKRZSA-N | | SMILES | Cc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)cc1 | | CAS DataBase Reference | 80102-26-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-4-Methylphe Usage And Synthesis |
| Uses | It is used as an active pharmaceutical intermediate. It is also an important organic intermediate used in agrochemicals, pharmaceuticals and dyestuff fields. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-4-Methylphe Preparation Products And Raw materials |
|