|
|
| | 2-Acetylbenzo[b]thiophene Basic information |
| | 2-Acetylbenzo[b]thiophene Chemical Properties |
| Melting point | 86-88°C | | Boiling point | 304.5±15.0 °C(Predicted) | | density | 1.219±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Light Brown to Brown | | InChI | InChI=1S/C10H8OS/c1-7(11)10-6-8-4-2-3-5-9(8)12-10/h2-6H,1H3 | | InChIKey | SGSGCQGCVKWRNM-UHFFFAOYSA-N | | SMILES | C(=O)(C1SC2=CC=CC=C2C=1)C | | CAS DataBase Reference | 22720-75-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-22 | | Safety Statements | 36-24/25 | | RIDADR | 3077 | | WGK Germany | 3 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29349990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 2-Acetylbenzo[b]thiophene Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | A novel anti-osteoporosis agent, by enhansing expression of the BMP-2 gene. | | Synthesis Reference(s) | Synthetic Communications, 23, p. 743, 1993 DOI: 10.1080/00397919308009834 |
| | 2-Acetylbenzo[b]thiophene Preparation Products And Raw materials |
|