|
|
| | 4-Methyl-5-nitroimidazole Basic information |
| | 4-Methyl-5-nitroimidazole Chemical Properties |
| Melting point | 249 °C (lit.) | | Boiling point | 235.85°C (rough estimate) | | density | 1.4748 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly, Sonicated) | | pka | 8.74±0.10(Predicted) | | form | Powder or Crystalline Powder | | color | White to light brown | | InChI | InChI=1S/C4H5N3O2/c1-3-4(7(8)9)6-2-5-3/h2H,1H3,(H,5,6) | | InChIKey | WSYOWIMKNNMEMZ-UHFFFAOYSA-N | | SMILES | C1NC([N+]([O-])=O)=C(C)N=1 | | NIST Chemistry Reference | Imidazole, 4-methyl-5-nitro-(14003-66-8) | | EPA Substance Registry System | 1H-Imidazole, 4-methyl-5-nitro- (14003-66-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | NI7562000 | | TSCA | TSCA listed | | HS Code | 2933299090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Methyl-5-nitroimidazole Usage And Synthesis |
| Uses | 5-Methyl-4-nitroimidazole can cause mutations with Klebsiella pneumonia and Salmonella typhimurium. | | Uses | 5-Methyl-4-nitroimidazole may be used in the following:
- To trap the reactive 1:1 intermediate formed during the reaction between triphenylphosphine and dibenzoylacetylene.
- As a starting reagent in the synthesis of pyrazole derivatives.
- Fabrication of zeolitic imidazolate frameworks (ZIFs).
| | General Description | 5-Methyl-4-nitroimidazole, an imidazole derivative, is a heterocyclic NH-acid. Its nitration in the presence of acetic anhydride/glacial acetic acid has been studied. |
| | 4-Methyl-5-nitroimidazole Preparation Products And Raw materials |
|