- 2-Di-1-ASP
-
- $29.00 / 50mg
-
2026-01-05
- CAS:2156-29-8
- Min. Order:
- Purity: 99.98%
- Supply Ability: 10g
- 2-DI-1-ASP
-
- $0.10 / 1KG
-
2025-12-24
- CAS:2156-29-8
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000 tons
|
| | 2-DI-1-ASP Basic information |
| Product Name: | 2-DI-1-ASP | | Synonyms: | 2-[P-(DIMETHYLAMINO)STYRYL]-1-METHYLPYRIDINIUM IODIDE;[2-(P-[DIMETHYLAMINO]STYRYL)PYRID-1-YL]METHYL IODIDE;2-DI-1-ASP;2-DI-1-ASP IODIDE;2-(4-(DIMETHYLAMINO)STYRYL)-N-METHYLPYRIDINIUM IODIDE;2-(4-DIMETHYLAMINOSTYRYL)-1-METHYLPYRIDINIUM IODIDE;1-METHYL-2-P-DIMETHYLAMINO-STYRYL-PYRIDINIUM-IODIDE;2-(4-(dimethylamino)styryl)-1-methylpyridinium | | CAS: | 2156-29-8 | | MF: | C16H19IN2 | | MW: | 366.24 | | EINECS: | 218-460-8 | | Product Categories: | | | Mol File: | 2156-29-8.mol |  |
| | 2-DI-1-ASP Chemical Properties |
| Melting point | 280 °C (dec.)(lit.) | | solubility | DMSO: soluble | | form | Solid | | color | Pink to red | | λmax | 466 nm | | BRN | 3776369 | | InChI | 1S/C16H19N2.HI/c1-17(2)15-10-7-14(8-11-15)9-12-16-6-4-5-13-18(16)3;/h4-13H,1-3H3;1H/q+1;/p-1 | | InChIKey | XPOIQAIBZGSIDD-UHFFFAOYSA-M | | SMILES | [I-].CN(C)c1ccc(cc1)\C=C\c2cccc[n+]2C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-DI-1-ASP Usage And Synthesis |
| Description | 2-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide, a synthetic compound with intricate chemical structure, finds application in the realm of scientific research. Noteworthy for its fluorescent properties, it functions as a vital tool in the visualization and identification of diverse biological entities such as proteins, DNA, and membranes. In the sphere of biomedical investigations, particularly in fluorescence microscopy and flow cytometry studies, this compound plays a pivotal role in enhancing the understanding of cellular processes. | | Uses | DASPMI is a polar sensitive dye that measures the membrane potential of mitochondria in living cells. It may be used as a light absorber in the development of a photoinitiator based system. | | Definition | ChEBI: 2-[4-(dimethylamino)styryl]-1-methylpyridinium iodide is a pyridinium salt, a tertiary amine and an organic iodide salt. It has a role as a fluorochrome. It contains a 2-[4-(dimethylamino)styryl]-1-methylpyridinium. | | General Description | 2-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide (DASPMI) is a mitochondria staining styryl dye that is used to generate a quick responsive mechanism by applying changes in transmembrane potential. DASPMI can be used as a low toxic stain that shows a fluorescent behavior for mitochondria. |
| | 2-DI-1-ASP Preparation Products And Raw materials |
|