- Theaflavin-3'-Gallate
-
- $68.00 / 1mg
-
2025-11-02
- CAS:28543-07-9
- Min. Order:
- Purity: 99.89%
- Supply Ability: 10g
- Theaflavin-3'-gallate
-
- $0.00 / 5mg
-
2023-02-24
- CAS:28543-07-9
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Theaflavin 3'-gallate
-
- $1.00 / 1kg
-
2019-07-06
- CAS:28543-07-9
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 1000kg
|
| | THEAFLAVIN 3'-O-GALLATE Basic information |
| Product Name: | THEAFLAVIN 3'-O-GALLATE | | Synonyms: | THEAFLAVIN 3'-O-GALLATE;[(2S,3R)-5,7-dihydroxy-2-[6,8,9-trihydroxy-5-oxo-3-[(2S,3R)-3,5,7-trihydroxychroman-2-yl]-11-bicyclo[5.4.0]undeca-1,3,6,8,10-pentaenyl]chroman-3-yl] 3,4,5-trihydroxybenzoate;THEAFLAVIN3GALLATE(3'-ISOMERICFORM);THEAFLAVINMONOGALLATEB;Theaflavin-3'-Gallate (TF-3'-G);3'-O-(3,4,5-Trihydroxybenzoyl);3,4,5-Trihydroxybenzoic acid (2R,3R)-2-[8-[(2R,3R)-3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-2-yl]-3,4,6-trihydroxy-5-oxo-5H-benzocyclohepten-1-yl]-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl ester;Theaflavin 2B | | CAS: | 28543-07-9 | | MF: | C36H28O16 | | MW: | 716.6 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 28543-07-9.mol |  |
| | THEAFLAVIN 3'-O-GALLATE Chemical Properties |
| Boiling point | 1226.9±65.0 °C(Predicted) | | density | 1.93 | | storage temp. | -20°C | | solubility | Soluble in ethanol and methan | | form | powder | | pka | 6.55±0.20(Predicted) | | color | Orange-brown | | InChIKey | GPLOTACQBREROW-WQLSNUALSA-N | | SMILES | C(O[C@@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1=C2C=C([C@H]3OC4=CC(O)=CC(O)=C4C[C@H]3O)C=C(O)C(=O)C2=C(O)C(O)=C1)(=O)C1=CC(O)=C(O)C(O)=C1 |
| | THEAFLAVIN 3'-O-GALLATE Usage And Synthesis |
| Chemical Properties | Brown-yellow powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from black tea. | | Uses | Theaflavin-3''-O-gallate is a theaflavin found in black tea that has shown to induce apoptosis through promoting mitochondrial dysfunction in human prostate cancer cells. | | IC 50 | OX: 7.6 μM (IC50) |
| | THEAFLAVIN 3'-O-GALLATE Preparation Products And Raw materials |
|